C19H32F3IN4O — CID 111248656
1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111248656) has the molecular formula C19H32F3IN4O and a molecular weight of 516.39 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111248656 |
| Molecular Formula | C19H32F3IN4O |
| Molecular Weight | 516.39 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN(C(C)C)C(C)C)NCc1cccc(OCC(F)(F)F)c1.I |
| InChI | InChI=1S/C19H31F3N4O.HI/c1-14(2)26(15(3)4)10-9-24-18(23-5)25-12-16-7-6-8-17(11-16)27-13-19(20,21)22;/h6-8,11,14-15H,9-10,12-13H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | FLDJVCYJUVACSL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|