C15H20F3NO4 — CID 87005494
N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 87005494) has the molecular formula C15H20F3NO4 and a molecular weight of 335.32 g/mol. Its IUPAC name is N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 87005494 |
| Molecular Formula | C15H20F3NO4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | COCCOc1cccc(CNC(=O)C(C)OCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO4/c1-11(23-10-15(16,17)18)14(20)19-9-12-4-3-5-13(8-12)22-7-6-21-2/h3-5,8,11H,6-7,9-10H2,1-2H3,(H,19,20) |
| InChIKey | HONGGZDDGPWINQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|