C13H21ClN2O3 — CID 119289322
3-amino-N-[[3-(2-methoxyethoxy)phenyl]methyl]propanamide;hydrochloride (PubChem CID 119289322) has the molecular formula C13H21ClN2O3 and a molecular weight of 288.78 g/mol. Its IUPAC name is 3-amino-N-[[3-(2-methoxyethoxy)phenyl]methyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[[3-(2-methoxyethoxy)phenyl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119289322 |
| Molecular Formula | C13H21ClN2O3 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-amino-N-[[3-(2-methoxyethoxy)phenyl]methyl]propanamide;hydrochloride |
| SMILES | COCCOc1cccc(CNC(=O)CCN)c1.Cl |
| InChI | InChI=1S/C13H20N2O3.ClH/c1-17-7-8-18-12-4-2-3-11(9-12)10-15-13(16)5-6-14;/h2-4,9H,5-8,10,14H2,1H3,(H,15,16);1H |
| InChIKey | GEDGZOIUOQVKAW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|