C25H26N2O3S — CID 55804446
N-[[3-(2-methoxyethoxy)phenyl]methyl]-3-phenothiazin-10-ylpropanamide (PubChem CID 55804446) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is N-[[3-(2-methoxyethoxy)phenyl]methyl]-3-phenothiazin-10-ylpropanamide.
| Compound Name | N-[[3-(2-methoxyethoxy)phenyl]methyl]-3-phenothiazin-10-ylpropanamide |
|---|---|
| PubChem CID | 55804446 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-[[3-(2-methoxyethoxy)phenyl]methyl]-3-phenothiazin-10-ylpropanamide |
| SMILES | COCCOc1cccc(CNC(=O)CCN2c3ccccc3Sc3ccccc32)c1 |
| InChI | InChI=1S/C25H26N2O3S/c1-29-15-16-30-20-8-6-7-19(17-20)18-26-25(28)13-14-27-21-9-2-4-11-23(21)31-24-12-5-3-10-22(24)27/h2-12,17H,13-16,18H2,1H3,(H,26,28) |
| InChIKey | UNADQBFRWBFBCV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|