C23H27N3O4 — CID 56577667
N'-(2-cyanoethyl)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-N'-phenylbutanediamide (PubChem CID 56577667) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56577667 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-N'-phenylbutanediamide |
| SMILES | COCCOc1cccc(CNC(=O)CCC(=O)N(CCC#N)c2ccccc2)c1 |
| InChI | InChI=1S/C23H27N3O4/c1-29-15-16-30-21-10-5-7-19(17-21)18-25-22(27)11-12-23(28)26(14-6-13-24)20-8-3-2-4-9-20/h2-5,7-10,17H,6,11-12,14-16,18H2,1H3,(H,25,27) |
| InChIKey | ZDTKUHVHEBPJGF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|