C18H18BrN3O2S — CID 56516643
N-[(5-bromothiophen-2-yl)methyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide (PubChem CID 56516643) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56516643 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)NCc1ccc(Br)s1)c1ccccc1 |
| InChI | InChI=1S/C18H18BrN3O2S/c19-16-8-7-15(25-16)13-21-17(23)9-10-18(24)22(12-4-11-20)14-5-2-1-3-6-14/h1-3,5-8H,4,9-10,12-13H2,(H,21,23) |
| InChIKey | BJKUYSBAVPUFDI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |