C18H20N4O4S2 — CID 56574675
N'-(2-cyanoethyl)-N'-phenyl-N-[(5-sulfamoylthiophen-2-yl)methyl]butanediamide (PubChem CID 56574675) has the molecular formula C18H20N4O4S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N'-phenyl-N-[(5-sulfamoylthiophen-2-yl)methyl]butanediamide.
| Compound Name | N'-(2-cyanoethyl)-N'-phenyl-N-[(5-sulfamoylthiophen-2-yl)methyl]butanediamide |
|---|---|
| PubChem CID | 56574675 |
| Molecular Formula | C18H20N4O4S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N'-(2-cyanoethyl)-N'-phenyl-N-[(5-sulfamoylthiophen-2-yl)methyl]butanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)NCc1ccc(S(N)(=O)=O)s1)c1ccccc1 |
| InChI | InChI=1S/C18H20N4O4S2/c19-11-4-12-22(14-5-2-1-3-6-14)17(24)9-8-16(23)21-13-15-7-10-18(27-15)28(20,25)26/h1-3,5-7,10H,4,8-9,12-13H2,(H,21,23)(H2,20,25,26) |
| InChIKey | DDLFSKSIBWVACZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 133.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |