C23H27N3O5 — CID 56577763
N'-(2-cyanoethyl)-N'-phenyl-N-[(2,4,6-trimethoxyphenyl)methyl]butanediamide (PubChem CID 56577763) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N'-phenyl-N-[(2,4,6-trimethoxyphenyl)methyl]butanediamide.
| Compound Name | N'-(2-cyanoethyl)-N'-phenyl-N-[(2,4,6-trimethoxyphenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 56577763 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N'-(2-cyanoethyl)-N'-phenyl-N-[(2,4,6-trimethoxyphenyl)methyl]butanediamide |
| SMILES | COc1cc(OC)c(CNC(=O)CCC(=O)N(CCC#N)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C23H27N3O5/c1-29-18-14-20(30-2)19(21(15-18)31-3)16-25-22(27)10-11-23(28)26(13-7-12-24)17-8-5-4-6-9-17/h4-6,8-9,14-15H,7,10-11,13,16H2,1-3H3,(H,25,27) |
| InChIKey | ALWPHAQSOPKEBD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |