C21H21Cl2N3O2 — CID 56538942
N'-(2-cyanoethyl)-N-[2-(3,5-dichlorophenyl)ethyl]-N'-phenylbutanediamide (PubChem CID 56538942) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[2-(3,5-dichlorophenyl)ethyl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[2-(3,5-dichlorophenyl)ethyl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56538942 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[2-(3,5-dichlorophenyl)ethyl]-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)NCCc1cc(Cl)cc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C21H21Cl2N3O2/c22-17-13-16(14-18(23)15-17)9-11-25-20(27)7-8-21(28)26(12-4-10-24)19-5-2-1-3-6-19/h1-3,5-6,13-15H,4,7-9,11-12H2,(H,25,27) |
| InChIKey | MJIZDDUOWHLTGD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |