C23H27N3O2 — CID 56516047
N-(4-butylphenyl)-N'-(2-cyanoethyl)-N'-phenylbutanediamide (PubChem CID 56516047) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(4-butylphenyl)-N'-(2-cyanoethyl)-N'-phenylbutanediamide.
| Compound Name | N-(4-butylphenyl)-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56516047 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-(4-butylphenyl)-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
| SMILES | CCCCc1ccc(NC(=O)CCC(=O)N(CCC#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-2-3-8-19-11-13-20(14-12-19)25-22(27)15-16-23(28)26(18-7-17-24)21-9-5-4-6-10-21/h4-6,9-14H,2-3,7-8,15-16,18H2,1H3,(H,25,27) |
| InChIKey | PPTCKOSOJYOWLN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |