C25H24N4O3 — CID 56513706
N'-(2-cyanoethyl)-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]-N'-phenylbutanediamide (PubChem CID 56513706) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56513706 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)Nc1ccc(Cn2ccccc2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H24N4O3/c26-16-6-18-29(22-7-2-1-3-8-22)25(32)15-14-23(30)27-21-12-10-20(11-13-21)19-28-17-5-4-9-24(28)31/h1-5,7-13,17H,6,14-15,18-19H2,(H,27,30) |
| InChIKey | LOJJBIXAQMFZJJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |