C25H29N5O4 — CID 56515080
N'-(2-cyanoethyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-N'-phenylbutanediamide (PubChem CID 56515080) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56515080 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)Nc1ccc(NC(=O)NCC2CCCO2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H29N5O4/c26-15-5-16-30(21-6-2-1-3-7-21)24(32)14-13-23(31)28-19-9-11-20(12-10-19)29-25(33)27-18-22-8-4-17-34-22/h1-3,6-7,9-12,22H,4-5,8,13-14,16-18H2,(H,28,31)(H2,27,29,33) |
| InChIKey | PMPRMTGONPNJJM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |