C15H23ClN4O3 — CID 119701961
2-(methylamino)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]acetamide;hydrochloride (PubChem CID 119701961) has the molecular formula C15H23ClN4O3 and a molecular weight of 342.83 g/mol. Its IUPAC name is 2-(methylamino)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]acetamide;hydrochloride.
| Compound Name | 2-(methylamino)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119701961 |
| Molecular Formula | C15H23ClN4O3 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-(methylamino)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]acetamide;hydrochloride |
| SMILES | CNCC(=O)Nc1ccc(NC(=O)NCC2CCCO2)cc1.Cl |
| InChI | InChI=1S/C15H22N4O3.ClH/c1-16-10-14(20)18-11-4-6-12(7-5-11)19-15(21)17-9-13-3-2-8-22-13;/h4-7,13,16H,2-3,8-10H2,1H3,(H,18,20)(H2,17,19,21);1H |
| InChIKey | LHRASKLVBVEMRM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |