C15H18F3N3O3S — CID 55651787
N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 55651787) has the molecular formula C15H18F3N3O3S and a molecular weight of 377.39 g/mol. Its IUPAC name is N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 55651787 |
| Molecular Formula | C15H18F3N3O3S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | O=C(CSC(F)(F)F)Nc1ccc(NC(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C15H18F3N3O3S/c16-15(17,18)25-9-13(22)20-10-3-5-11(6-4-10)21-14(23)19-8-12-2-1-7-24-12/h3-6,12H,1-2,7-9H2,(H,20,22)(H2,19,21,23) |
| InChIKey | QPZQDEHYHVPCAR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |