C19H28N4O3 — CID 134039404
1-cyclohexyl-3-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]urea (PubChem CID 134039404) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]urea |
|---|---|
| PubChem CID | 134039404 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-cyclohexyl-3-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]urea |
| SMILES | O=C(NCC1CCCO1)Nc1ccc(NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H28N4O3/c24-18(20-13-17-7-4-12-26-17)21-15-8-10-16(11-9-15)23-19(25)22-14-5-2-1-3-6-14/h8-11,14,17H,1-7,12-13H2,(H2,20,21,24)(H2,22,23,25) |
| InChIKey | SFIJXSIOBFFBBT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |