C16H23N3O3 — CID 17180641
4-(oxolan-2-ylmethylcarbamoylamino)-N-propan-2-ylbenzamide (PubChem CID 17180641) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(oxolan-2-ylmethylcarbamoylamino)-N-propan-2-ylbenzamide.
| Compound Name | 4-(oxolan-2-ylmethylcarbamoylamino)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 17180641 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 4-(oxolan-2-ylmethylcarbamoylamino)-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(NC(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C16H23N3O3/c1-11(2)18-15(20)12-5-7-13(8-6-12)19-16(21)17-10-14-4-3-9-22-14/h5-8,11,14H,3-4,9-10H2,1-2H3,(H,18,20)(H2,17,19,21) |
| InChIKey | UBTCUCXZGJLRJY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |