C19H21N3O3 — CID 42427521
N-[[(2R)-oxolan-2-yl]methyl]-4-(phenylcarbamoylamino)benzamide (PubChem CID 42427521) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-4-(phenylcarbamoylamino)benzamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-4-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 42427521 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-4-(phenylcarbamoylamino)benzamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C(=O)NC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H21N3O3/c23-18(20-13-17-7-4-12-25-17)14-8-10-16(11-9-14)22-19(24)21-15-5-2-1-3-6-15/h1-3,5-6,8-11,17H,4,7,12-13H2,(H,20,23)(H2,21,22,24)/t17-/m1/s1 |
| InChIKey | YSOAHTFXCZNHAM-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |