C19H20ClN3O3 — CID 17205676
4-[(3-chlorophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17205676) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-[(3-chlorophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17205676 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-[(3-chlorophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(C(=O)NCC2CCCO2)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O3/c20-14-3-1-4-16(11-14)23-19(25)22-15-8-6-13(7-9-15)18(24)21-12-17-5-2-10-26-17/h1,3-4,6-9,11,17H,2,5,10,12H2,(H,21,24)(H2,22,23,25) |
| InChIKey | IYYHWNXJTLISDX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |