C18H18ClN3O3 — CID 109096215
6-N-(3-chlorophenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide (PubChem CID 109096215) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is 6-N-(3-chlorophenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(3-chlorophenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109096215 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 6-N-(3-chlorophenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCC1CCCO1)c1cccc(C(=O)Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C18H18ClN3O3/c19-12-4-1-5-13(10-12)21-18(24)16-8-2-7-15(22-16)17(23)20-11-14-6-3-9-25-14/h1-2,4-5,7-8,10,14H,3,6,9,11H2,(H,20,23)(H,21,24) |
| InChIKey | REFIHIHAKZTFHE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |