C17H23N3O4 — CID 4668561
2-N,6-N-bis(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide (PubChem CID 4668561) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-N,6-N-bis(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 4668561 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-N,6-N-bis(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCC1CCCO1)c1cccc(C(=O)NCC2CCCO2)n1 |
| InChI | InChI=1S/C17H23N3O4/c21-16(18-10-12-4-2-8-23-12)14-6-1-7-15(20-14)17(22)19-11-13-5-3-9-24-13/h1,6-7,12-13H,2-5,8-11H2,(H,18,21)(H,19,22) |
| InChIKey | BMYLLSSZYYJQAV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |