C17H25N3O3 — CID 109096180
2-N-(3-methylbutyl)-6-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide (PubChem CID 109096180) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-N-(3-methylbutyl)-6-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-(3-methylbutyl)-6-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109096180 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-N-(3-methylbutyl)-6-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide |
| SMILES | CC(C)CCNC(=O)c1cccc(C(=O)NCC2CCCO2)n1 |
| InChI | InChI=1S/C17H25N3O3/c1-12(2)8-9-18-16(21)14-6-3-7-15(20-14)17(22)19-11-13-5-4-10-23-13/h3,6-7,12-13H,4-5,8-11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | LMBPYBCCNAOQEU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |