C22H30N4O2 — CID 109301022
2-[2,6-di(propan-2-yl)anilino]-N-(oxolan-2-ylmethyl)pyrimidine-4-carboxamide (PubChem CID 109301022) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)anilino]-N-(oxolan-2-ylmethyl)pyrimidine-4-carboxamide.
| Compound Name | 2-[2,6-di(propan-2-yl)anilino]-N-(oxolan-2-ylmethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109301022 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)anilino]-N-(oxolan-2-ylmethyl)pyrimidine-4-carboxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1Nc1nccc(C(=O)NCC2CCCO2)n1 |
| InChI | InChI=1S/C22H30N4O2/c1-14(2)17-8-5-9-18(15(3)4)20(17)26-22-23-11-10-19(25-22)21(27)24-13-16-7-6-12-28-16/h5,8-11,14-16H,6-7,12-13H2,1-4H3,(H,24,27)(H,23,25,26) |
| InChIKey | SRWKITJAHOHIEY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |