C15H24N4O2 — CID 109300934
N-(oxolan-2-ylmethyl)-2-(pentylamino)pyrimidine-4-carboxamide (PubChem CID 109300934) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-(pentylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-(pentylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109300934 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-(pentylamino)pyrimidine-4-carboxamide |
| SMILES | CCCCCNc1nccc(C(=O)NCC2CCCO2)n1 |
| InChI | InChI=1S/C15H24N4O2/c1-2-3-4-8-16-15-17-9-7-13(19-15)14(20)18-11-12-6-5-10-21-12/h7,9,12H,2-6,8,10-11H2,1H3,(H,18,20)(H,16,17,19) |
| InChIKey | GMPALBAJKPOIIZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|