C16H23N3O3 — CID 109096177
6-N-tert-butyl-2-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide (PubChem CID 109096177) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 6-N-tert-butyl-2-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-tert-butyl-2-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109096177 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 6-N-tert-butyl-2-N-(oxolan-2-ylmethyl)pyridine-2,6-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(C(=O)NCC2CCCO2)n1 |
| InChI | InChI=1S/C16H23N3O3/c1-16(2,3)19-15(21)13-8-4-7-12(18-13)14(20)17-10-11-6-5-9-22-11/h4,7-8,11H,5-6,9-10H2,1-3H3,(H,17,20)(H,19,21) |
| InChIKey | XJKJJVJCTAVISQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |