C18H19N3O3 — CID 109103938
3-N-(oxolan-2-ylmethyl)-5-N-phenylpyridine-3,5-dicarboxamide (PubChem CID 109103938) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-N-(oxolan-2-ylmethyl)-5-N-phenylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(oxolan-2-ylmethyl)-5-N-phenylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109103938 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-N-(oxolan-2-ylmethyl)-5-N-phenylpyridine-3,5-dicarboxamide |
| SMILES | O=C(NCC1CCCO1)c1cncc(C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C18H19N3O3/c22-17(20-12-16-7-4-8-24-16)13-9-14(11-19-10-13)18(23)21-15-5-2-1-3-6-15/h1-3,5-6,9-11,16H,4,7-8,12H2,(H,20,22)(H,21,23) |
| InChIKey | HULQQNDLVHHBBO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |