C21H23N3O4 — CID 109053089
3-N-(4-acetamidophenyl)-1-N-(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide (PubChem CID 109053089) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-N-(4-acetamidophenyl)-1-N-(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(4-acetamidophenyl)-1-N-(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109053089 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-N-(4-acetamidophenyl)-1-N-(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cccc(C(=O)NCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-14(25)23-17-7-9-18(10-8-17)24-21(27)16-5-2-4-15(12-16)20(26)22-13-19-6-3-11-28-19/h2,4-5,7-10,12,19H,3,6,11,13H2,1H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | FGCMYVNVSVMJID-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |