C20H23N3O5S — CID 24539464
N-(4-acetamidophenyl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 24539464) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(4-acetamidophenyl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24539464 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-(4-acetamidophenyl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cccc(S(=O)(=O)NCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C20H23N3O5S/c1-14(24)22-16-7-9-17(10-8-16)23-20(25)15-4-2-6-19(12-15)29(26,27)21-13-18-5-3-11-28-18/h2,4,6-10,12,18,21H,3,5,11,13H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | DSZNBBOMAXJIBC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |