C25H24N2O4S — CID 46539920
N-(9H-fluoren-2-yl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 46539920) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is N-(9H-fluoren-2-yl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(9H-fluoren-2-yl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46539920 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-(9H-fluoren-2-yl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)Cc1ccccc1-2)c1cccc(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C25H24N2O4S/c28-25(27-20-10-11-24-19(14-20)13-17-5-1-2-9-23(17)24)18-6-3-8-22(15-18)32(29,30)26-16-21-7-4-12-31-21/h1-3,5-6,8-11,14-15,21,26H,4,7,12-13,16H2,(H,27,28) |
| InChIKey | WBFRUEDTIPXNMT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |