C19H19N3O4S — CID 109063915
N-(4-cyanophenyl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 109063915) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(4-cyanophenyl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 109063915 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-(4-cyanophenyl)-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cccc(S(=O)(=O)NCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C19H19N3O4S/c20-12-14-6-8-16(9-7-14)22-19(23)15-3-1-5-18(11-15)27(24,25)21-13-17-4-2-10-26-17/h1,3,5-9,11,17,21H,2,4,10,13H2,(H,22,23) |
| InChIKey | DGBLPNQIJAWNGW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |