C28H30N4O4 — CID 54837105
3-methyl-N-[4-[[2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]acetyl]amino]phenyl]benzamide (PubChem CID 54837105) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is 3-methyl-N-[4-[[2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]acetyl]amino]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[[2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 54837105 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 3-methyl-N-[4-[[2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]acetyl]amino]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(NC(=O)CNc3cccc(C(=O)NCC4CCCO4)c3)cc2)c1 |
| InChI | InChI=1S/C28H30N4O4/c1-19-5-2-6-20(15-19)28(35)32-23-12-10-22(11-13-23)31-26(33)18-29-24-8-3-7-21(16-24)27(34)30-17-25-9-4-14-36-25/h2-3,5-8,10-13,15-16,25,29H,4,9,14,17-18H2,1H3,(H,30,34)(H,31,33)(H,32,35) |
| InChIKey | PIUUKYVICAZJRO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |