C21H24N4O4 — CID 54842684
3-[[2-oxo-2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]ethyl]amino]benzamide (PubChem CID 54842684) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-[[2-oxo-2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]ethyl]amino]benzamide.
| Compound Name | 3-[[2-oxo-2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54842684 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-[[2-oxo-2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]ethyl]amino]benzamide |
| SMILES | NC(=O)c1cccc(NCC(=O)Nc2cccc(C(=O)NCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C21H24N4O4/c22-20(27)14-4-1-6-16(10-14)23-13-19(26)25-17-7-2-5-15(11-17)21(28)24-12-18-8-3-9-29-18/h1-2,4-7,10-11,18,23H,3,8-9,12-13H2,(H2,22,27)(H,24,28)(H,25,26) |
| InChIKey | FXWXDWUVFZXHLI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |