C20H21Cl2N3O3 — CID 54837036
3-[[2-(2,3-dichloroanilino)-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 54837036) has the molecular formula C20H21Cl2N3O3 and a molecular weight of 422.31 g/mol. Its IUPAC name is 3-[[2-(2,3-dichloroanilino)-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-(2,3-dichloroanilino)-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54837036 |
| Molecular Formula | C20H21Cl2N3O3 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 3-[[2-(2,3-dichloroanilino)-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(CNc1cccc(C(=O)NCC2CCCO2)c1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H21Cl2N3O3/c21-16-7-2-8-17(19(16)22)25-18(26)12-23-14-5-1-4-13(10-14)20(27)24-11-15-6-3-9-28-15/h1-2,4-5,7-8,10,15,23H,3,6,9,11-12H2,(H,24,27)(H,25,26) |
| InChIKey | HKXCTIPVUIFLAB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |