C24H29ClN4O4 — CID 54830953
3-[[2-[5-(butanoylamino)-2-chloroanilino]acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 54830953) has the molecular formula C24H29ClN4O4 and a molecular weight of 472.97 g/mol. Its IUPAC name is 3-[[2-[5-(butanoylamino)-2-chloroanilino]acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-[5-(butanoylamino)-2-chloroanilino]acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54830953 |
| Molecular Formula | C24H29ClN4O4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 3-[[2-[5-(butanoylamino)-2-chloroanilino]acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NCC(=O)Nc2cccc(C(=O)NCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C24H29ClN4O4/c1-2-5-22(30)28-18-9-10-20(25)21(13-18)26-15-23(31)29-17-7-3-6-16(12-17)24(32)27-14-19-8-4-11-33-19/h3,6-7,9-10,12-13,19,26H,2,4-5,8,11,14-15H2,1H3,(H,27,32)(H,28,30)(H,29,31) |
| InChIKey | MKNSFRWZYXIZOZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |