C22H27N3O5 — CID 54813901
3-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 54813901) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 3-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54813901 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccc(OC)c(NCC(=O)Nc2cccc(C(=O)NCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C22H27N3O5/c1-28-17-8-9-20(29-2)19(12-17)23-14-21(26)25-16-6-3-5-15(11-16)22(27)24-13-18-7-4-10-30-18/h3,5-6,8-9,11-12,18,23H,4,7,10,13-14H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | KKCXFRYBJDEPGP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |