C23H28N4O4 — CID 54837003
3-[[2-[4-[acetyl(methyl)amino]anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 54837003) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[[2-[4-[acetyl(methyl)amino]anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-[4-[acetyl(methyl)amino]anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54837003 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 3-[[2-[4-[acetyl(methyl)amino]anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CC(=O)N(C)c1ccc(NC(=O)CNc2cccc(C(=O)NCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-16(28)27(2)20-10-8-18(9-11-20)26-22(29)15-24-19-6-3-5-17(13-19)23(30)25-14-21-7-4-12-31-21/h3,5-6,8-11,13,21,24H,4,7,12,14-15H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | MXMJWXSOEJCSDO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |