C19H20FN3O3 — CID 75800008
3-fluoro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]benzamide (PubChem CID 75800008) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is 3-fluoro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 75800008 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-fluoro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]benzamide |
| SMILES | O=C(NCC1CCCO1)Nc1ccc(NC(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H20FN3O3/c20-14-4-1-3-13(11-14)18(24)22-15-6-8-16(9-7-15)23-19(25)21-12-17-5-2-10-26-17/h1,3-4,6-9,11,17H,2,5,10,12H2,(H,22,24)(H2,21,23,25) |
| InChIKey | CIESEZPEUFDDSU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |