C19H19F2N3O3 — CID 134050539
2,5-difluoro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]benzamide (PubChem CID 134050539) has the molecular formula C19H19F2N3O3 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2,5-difluoro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]benzamide.
| Compound Name | 2,5-difluoro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 134050539 |
| Molecular Formula | C19H19F2N3O3 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2,5-difluoro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]benzamide |
| SMILES | O=C(NCC1CCCO1)Nc1ccc(NC(=O)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C19H19F2N3O3/c20-12-3-8-17(21)16(10-12)18(25)23-13-4-6-14(7-5-13)24-19(26)22-11-15-2-1-9-27-15/h3-8,10,15H,1-2,9,11H2,(H,23,25)(H2,22,24,26) |
| InChIKey | VLFQGJATFAQFLN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |