C13H14F2N2O4 — CID 62866631
4,5-difluoro-2-(oxolan-2-ylmethylcarbamoylamino)benzoic acid (PubChem CID 62866631) has the molecular formula C13H14F2N2O4 and a molecular weight of 300.26 g/mol. Its IUPAC name is 4,5-difluoro-2-(oxolan-2-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 4,5-difluoro-2-(oxolan-2-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 62866631 |
| Molecular Formula | C13H14F2N2O4 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4,5-difluoro-2-(oxolan-2-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCC1CCCO1)Nc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C13H14F2N2O4/c14-9-4-8(12(18)19)11(5-10(9)15)17-13(20)16-6-7-2-1-3-21-7/h4-5,7H,1-3,6H2,(H,18,19)(H2,16,17,20) |
| InChIKey | VSHVTCAXKLPGQY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |