C13H16N2O5 — CID 61191613
2-hydroxy-4-(oxolan-2-ylmethylcarbamoylamino)benzoic acid (PubChem CID 61191613) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-hydroxy-4-(oxolan-2-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 2-hydroxy-4-(oxolan-2-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 61191613 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-hydroxy-4-(oxolan-2-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCC1CCCO1)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C13H16N2O5/c16-11-6-8(3-4-10(11)12(17)18)15-13(19)14-7-9-2-1-5-20-9/h3-4,6,9,16H,1-2,5,7H2,(H,17,18)(H2,14,15,19) |
| InChIKey | QYALTVADDKCRNW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |