C17H24N4O5 — CID 122079897
4-[[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]carbamoylamino]butanoic acid (PubChem CID 122079897) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-[[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122079897 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-[[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1ccc(NC(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C17H24N4O5/c22-15(23)4-1-9-18-16(24)20-12-5-7-13(8-6-12)21-17(25)19-11-14-3-2-10-26-14/h5-8,14H,1-4,9-11H2,(H,22,23)(H2,18,20,24)(H2,19,21,25) |
| InChIKey | LJZYWQUIIJXJGH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|