C24H29N5O3 — CID 78882935
1-(3-indol-1-ylpropyl)-3-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]urea (PubChem CID 78882935) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 1-(3-indol-1-ylpropyl)-3-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]urea.
| Compound Name | 1-(3-indol-1-ylpropyl)-3-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]urea |
|---|---|
| PubChem CID | 78882935 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-(3-indol-1-ylpropyl)-3-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]urea |
| SMILES | O=C(NCCCn1ccc2ccccc21)Nc1ccc(NC(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C24H29N5O3/c30-23(25-13-4-14-29-15-12-18-5-1-2-7-22(18)29)27-19-8-10-20(11-9-19)28-24(31)26-17-21-6-3-16-32-21/h1-2,5,7-12,15,21H,3-4,6,13-14,16-17H2,(H2,25,27,30)(H2,26,28,31) |
| InChIKey | KFFITHZHAQMDLA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|