C23H27N3O3 — CID 78877780
1-(3-indol-1-ylpropyl)-3-[3-(oxolan-2-ylmethoxy)phenyl]urea (PubChem CID 78877780) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-(3-indol-1-ylpropyl)-3-[3-(oxolan-2-ylmethoxy)phenyl]urea.
| Compound Name | 1-(3-indol-1-ylpropyl)-3-[3-(oxolan-2-ylmethoxy)phenyl]urea |
|---|---|
| PubChem CID | 78877780 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 1-(3-indol-1-ylpropyl)-3-[3-(oxolan-2-ylmethoxy)phenyl]urea |
| SMILES | O=C(NCCCn1ccc2ccccc21)Nc1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C23H27N3O3/c27-23(24-12-5-13-26-14-11-18-6-1-2-10-22(18)26)25-19-7-3-8-20(16-19)29-17-21-9-4-15-28-21/h1-3,6-8,10-11,14,16,21H,4-5,9,12-13,15,17H2,(H2,24,25,27) |
| InChIKey | GZPDUBHOPPIIQV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|