C20H22N2O5 — CID 122075807
4-[[[3-(oxolan-2-ylmethoxy)phenyl]carbamoylamino]methyl]benzoic acid (PubChem CID 122075807) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-[[[3-(oxolan-2-ylmethoxy)phenyl]carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[3-(oxolan-2-ylmethoxy)phenyl]carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122075807 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 4-[[[3-(oxolan-2-ylmethoxy)phenyl]carbamoylamino]methyl]benzoic acid |
| SMILES | O=C(NCc1ccc(C(=O)O)cc1)Nc1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C20H22N2O5/c23-19(24)15-8-6-14(7-9-15)12-21-20(25)22-16-3-1-4-17(11-16)27-13-18-5-2-10-26-18/h1,3-4,6-9,11,18H,2,5,10,12-13H2,(H,23,24)(H2,21,22,25) |
| InChIKey | UIMPJMSFLMWDTR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |