C16H16N2O4 — CID 108869139
4-[[(3-methoxyphenyl)carbamoylamino]methyl]benzoic acid (PubChem CID 108869139) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 4-[[(3-methoxyphenyl)carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[(3-methoxyphenyl)carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108869139 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-[[(3-methoxyphenyl)carbamoylamino]methyl]benzoic acid |
| SMILES | COc1cccc(NC(=O)NCc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C16H16N2O4/c1-22-14-4-2-3-13(9-14)18-16(21)17-10-11-5-7-12(8-6-11)15(19)20/h2-9H,10H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | YOEQXMHSCKBSKA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |