C24H26N4O4 — CID 1243878
1-[(4-methoxyphenyl)methyl]-3-[3-[(4-methoxyphenyl)methylcarbamoylamino]phenyl]urea (PubChem CID 1243878) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[3-[(4-methoxyphenyl)methylcarbamoylamino]phenyl]urea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[3-[(4-methoxyphenyl)methylcarbamoylamino]phenyl]urea |
|---|---|
| PubChem CID | 1243878 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[3-[(4-methoxyphenyl)methylcarbamoylamino]phenyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2cccc(NC(=O)NCc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C24H26N4O4/c1-31-21-10-6-17(7-11-21)15-25-23(29)27-19-4-3-5-20(14-19)28-24(30)26-16-18-8-12-22(32-2)13-9-18/h3-14H,15-16H2,1-2H3,(H2,25,27,29)(H2,26,28,30) |
| InChIKey | OREVQXHCLJXQNI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |