C18H21N3O4 — CID 38167581
N-[3-[(3,4-dimethoxyphenyl)methylcarbamoylamino]phenyl]acetamide (PubChem CID 38167581) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[3-[(3,4-dimethoxyphenyl)methylcarbamoylamino]phenyl]acetamide.
| Compound Name | N-[3-[(3,4-dimethoxyphenyl)methylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 38167581 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[3-[(3,4-dimethoxyphenyl)methylcarbamoylamino]phenyl]acetamide |
| SMILES | COc1ccc(CNC(=O)Nc2cccc(NC(C)=O)c2)cc1OC |
| InChI | InChI=1S/C18H21N3O4/c1-12(22)20-14-5-4-6-15(10-14)21-18(23)19-11-13-7-8-16(24-2)17(9-13)25-3/h4-10H,11H2,1-3H3,(H,20,22)(H2,19,21,23) |
| InChIKey | ZDNVIJBYZXGJHP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |