C20H23N3O4 — CID 38169678
1-[(3,4-dimethoxyphenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]urea (PubChem CID 38169678) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]urea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 38169678 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2cccc(N3CCCC3=O)c2)cc1OC |
| InChI | InChI=1S/C20H23N3O4/c1-26-17-9-8-14(11-18(17)27-2)13-21-20(25)22-15-5-3-6-16(12-15)23-10-4-7-19(23)24/h3,5-6,8-9,11-12H,4,7,10,13H2,1-2H3,(H2,21,22,25) |
| InChIKey | GLWWXIICYDIBJZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |