C18H18FN3O2 — CID 38169682
1-[(4-fluorophenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]urea (PubChem CID 38169682) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 38169682 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]urea |
| SMILES | O=C(NCc1ccc(F)cc1)Nc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C18H18FN3O2/c19-14-8-6-13(7-9-14)12-20-18(24)21-15-3-1-4-16(11-15)22-10-2-5-17(22)23/h1,3-4,6-9,11H,2,5,10,12H2,(H2,20,21,24) |
| InChIKey | JSCFHJJPZYFENA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |