C19H27N3O2S — CID 47033900
1-(2-cyclopentylsulfanylethyl)-3-[3-(2-oxopiperidin-1-yl)phenyl]urea (PubChem CID 47033900) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-(2-cyclopentylsulfanylethyl)-3-[3-(2-oxopiperidin-1-yl)phenyl]urea.
| Compound Name | 1-(2-cyclopentylsulfanylethyl)-3-[3-(2-oxopiperidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 47033900 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-(2-cyclopentylsulfanylethyl)-3-[3-(2-oxopiperidin-1-yl)phenyl]urea |
| SMILES | O=C(NCCSC1CCCC1)Nc1cccc(N2CCCCC2=O)c1 |
| InChI | InChI=1S/C19H27N3O2S/c23-18-10-3-4-12-22(18)16-7-5-6-15(14-16)21-19(24)20-11-13-25-17-8-1-2-9-17/h5-7,14,17H,1-4,8-13H2,(H2,20,21,24) |
| InChIKey | UVEJGZYARDLVBH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|