C19H21N3OS2 — CID 92541830
1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-(2-phenylsulfanylethyl)thiourea (PubChem CID 92541830) has the molecular formula C19H21N3OS2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-(2-phenylsulfanylethyl)thiourea.
| Compound Name | 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-(2-phenylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 92541830 |
| Molecular Formula | C19H21N3OS2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-(2-phenylsulfanylethyl)thiourea |
| SMILES | O=C1CCCN1c1cccc(NC(=S)NCCSc2ccccc2)c1 |
| InChI | InChI=1S/C19H21N3OS2/c23-18-10-5-12-22(18)16-7-4-6-15(14-16)21-19(24)20-11-13-25-17-8-2-1-3-9-17/h1-4,6-9,14H,5,10-13H2,(H2,20,21,24) |
| InChIKey | KEOHZPXRZQJUMC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|